About 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide
2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 154838309) has the molecular formula C16H15ClN2O3
and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide |
| PubChem CID | 154838309 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | CC1(C)Cc2cc(NC(=O)c3cc(Cl)[nH]c(=O)c3)ccc2O1 |
| InChI | InChI=1S/C16H15ClN2O3/c1-16(2)8-10-5-11(3-4-12(10)22-16)18-15(21)9-6-13(17)19-14(20)7-9/h3-7H,8H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | VGUABIJMTOPWQY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide?
The IUPAC name of 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide (CID 154838309) is 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide.
What is the SMILES notation for 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide?
The canonical SMILES for 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide is CC1(C)Cc2cc(NC(=O)c3cc(Cl)[nH]c(=O)c3)ccc2O1.
What is the InChIKey of 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide?
The InChIKey is VGUABIJMTOPWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2O3/c1-16(2)8-10-5-11(3-4-12(10)22-16)18-15(21)9-6-13(17)19-14(20)7-9/h3-7H,8H2,1-2H3,(H,18,21)(H,19,20).
What are the key properties of 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide?
2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide has a molecular weight of 318.76 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,2-dimethyl-3H-1-benzofuran-5-yl)-6-oxo-1H-pyridine-4-carboxamide is sourced from PubChem (CID 154838309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).