About N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide
N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide (PubChem CID 154838842) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide |
| PubChem CID | 154838842 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide |
| SMILES | CCN(c1cccnc1)S(=O)(=O)c1c(C)nn(CC)c1C |
| InChI | InChI=1S/C14H20N4O2S/c1-5-17-12(4)14(11(3)16-17)21(19,20)18(6-2)13-8-7-9-15-10-13/h7-10H,5-6H2,1-4H3 |
| InChIKey | IOVOTKHBNVFZKE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide?
The IUPAC name of N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide (CID 154838842) is N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide.
What is the SMILES notation for N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide?
The canonical SMILES for N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide is CCN(c1cccnc1)S(=O)(=O)c1c(C)nn(CC)c1C.
What is the InChIKey of N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide?
The InChIKey is IOVOTKHBNVFZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2S/c1-5-17-12(4)14(11(3)16-17)21(19,20)18(6-2)13-8-7-9-15-10-13/h7-10H,5-6H2,1-4H3.
What are the key properties of N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide?
N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide has a molecular weight of 308.41 g/mol, XLogP of 2.13, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-diethyl-3,5-dimethyl-N-pyridin-3-ylpyrazole-4-sulfonamide is sourced from PubChem (CID 154838842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).