About N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide
N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 154840021) has the molecular formula C16H13Cl2N3OS
and a molecular weight of 366.27 g/mol. Its IUPAC name is N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 154840021 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc[nH]1)c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C16H13Cl2N3OS/c1-9(20-15(22)13-3-2-6-19-13)16-21-14(8-23-16)11-5-4-10(17)7-12(11)18/h2-9,19H,1H3,(H,20,22) |
| InChIKey | SPNCHRUDUVDRRI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide (CID 154840021) is N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide is CC(NC(=O)c1ccc[nH]1)c1nc(-c2ccc(Cl)cc2Cl)cs1.
What is the InChIKey of N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide?
The InChIKey is SPNCHRUDUVDRRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N3OS/c1-9(20-15(22)13-3-2-6-19-13)16-21-14(8-23-16)11-5-4-10(17)7-12(11)18/h2-9,19H,1H3,(H,20,22).
What are the key properties of N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide?
N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide has a molecular weight of 366.27 g/mol, XLogP of 4.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 154840021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).