C25H17N5O3 — CID 154840072
N-[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 154840072) has the molecular formula C25H17N5O3 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 154840072 |
| Molecular Formula | C25H17N5O3 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)Nc1n[nH]c(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C25H17N5O3/c31-22(26-25-27-24(28-29-25)21-13-15-7-1-6-12-20(15)33-21)14-30-18-10-4-2-8-16(18)23(32)17-9-3-5-11-19(17)30/h1-13H,14H2,(H2,26,27,28,29,31) |
| InChIKey | XYEOEHJGRZYNCE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|