C19H26N4O3S — CID 154840231
1-(benzenesulfonyl)-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]piperidine-2-carboxamide (PubChem CID 154840231) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 154840231 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]piperidine-2-carboxamide |
| SMILES | Cc1cc(CC(C)NC(=O)C2CCCCN2S(=O)(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H26N4O3S/c1-14(12-16-13-15(2)21-22-16)20-19(24)18-10-6-7-11-23(18)27(25,26)17-8-4-3-5-9-17/h3-5,8-9,13-14,18H,6-7,10-12H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | GUTKKIASHAVPGA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |