C15H14F6N4O3 — CID 154840307
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea (PubChem CID 154840307) has the molecular formula C15H14F6N4O3 and a molecular weight of 412.29 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 154840307 |
| Molecular Formula | C15H14F6N4O3 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-methyl-1H-pyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C15H14F6N4O3/c1-8-2-12(25-24-8)23-13(26)22-9-3-10(27-6-14(16,17)18)5-11(4-9)28-7-15(19,20)21/h2-5H,6-7H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | FLACOBLQCFURTB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |