C24H19N5O2 — CID 154840665
1-benzyl-N'-(4-oxo-3H-quinazolin-2-yl)indole-5-carbohydrazide (PubChem CID 154840665) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 1-benzyl-N'-(4-oxo-3H-quinazolin-2-yl)indole-5-carbohydrazide.
| Compound Name | 1-benzyl-N'-(4-oxo-3H-quinazolin-2-yl)indole-5-carbohydrazide |
|---|---|
| PubChem CID | 154840665 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 1-benzyl-N'-(4-oxo-3H-quinazolin-2-yl)indole-5-carbohydrazide |
| SMILES | O=C(NNc1nc2ccccc2c(=O)[nH]1)c1ccc2c(ccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H19N5O2/c30-22(27-28-24-25-20-9-5-4-8-19(20)23(31)26-24)18-10-11-21-17(14-18)12-13-29(21)15-16-6-2-1-3-7-16/h1-14H,15H2,(H,27,30)(H2,25,26,28,31) |
| InChIKey | RWVPRAILBFDQCW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|