About 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one
2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one (PubChem CID 154840845) has the molecular formula C14H13ClN2O3S
and a molecular weight of 324.79 g/mol. Its IUPAC name is 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one |
| PubChem CID | 154840845 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(SCc2cc(Cl)c3c(c2)OCO3)n1 |
| InChI | InChI=1S/C14H13ClN2O3S/c1-2-9-5-12(18)17-14(16-9)21-6-8-3-10(15)13-11(4-8)19-7-20-13/h3-5H,2,6-7H2,1H3,(H,16,17,18) |
| InChIKey | CGPLWXLTMLIGQN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one?
The IUPAC name of 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one (CID 154840845) is 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one is CCc1cc(=O)[nH]c(SCc2cc(Cl)c3c(c2)OCO3)n1.
What is the InChIKey of 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one?
The InChIKey is CGPLWXLTMLIGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O3S/c1-2-9-5-12(18)17-14(16-9)21-6-8-3-10(15)13-11(4-8)19-7-20-13/h3-5H,2,6-7H2,1H3,(H,16,17,18).
What are the key properties of 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one?
2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one has a molecular weight of 324.79 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-ethyl-1H-pyrimidin-6-one is sourced from PubChem (CID 154840845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).