C20H16N2O5 — CID 1548411
2-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid (PubChem CID 1548411) has the molecular formula C20H16N2O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 1548411 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | COC1=CC2=C(C=C1)NC=C2CCN3C(=O)C4=C(C3=O)C=C(C=C4)C(=O)O |
| InChI | InChI=1S/C20H16N2O5/c1-27-13-3-5-17-15(9-13)12(10-21-17)6-7-22-18(23)14-4-2-11(20(25)26)8-16(14)19(22)24/h2-5,8-10,21H,6-7H2,1H3,(H,25,26) |
| InChIKey | IZPLFMIPIZZAAU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | 623 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|