About (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene
(2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 154841528) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 154841528 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CCS(=O)(=O)N1C[C@@H]2C3C=CC(C3)[C@@H]2C1 |
| InChI | InChI=1S/C11H17NO2S/c1-2-15(13,14)12-6-10-8-3-4-9(5-8)11(10)7-12/h3-4,8-11H,2,5-7H2,1H3/t8?,9?,10-,11+ |
| InChIKey | CTJNMXAYUUCOIL-HWACXVBKSA-N |
| XLogP | 1.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene (CID 154841528) is (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene is CCS(=O)(=O)N1C[C@@H]2C3C=CC(C3)[C@@H]2C1.
What is the InChIKey of (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is CTJNMXAYUUCOIL-HWACXVBKSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-2-15(13,14)12-6-10-8-3-4-9(5-8)11(10)7-12/h3-4,8-11H,2,5-7H2,1H3/t8?,9?,10-,11+.
What are the key properties of (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene?
(2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 227.33 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-4-ethylsulfonyl-4-azatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 154841528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).