C11H19NO2S — CID 154841529
4-methylsulfonyl-4-azatricyclo[5.2.2.02,6]undecane (PubChem CID 154841529) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 4-methylsulfonyl-4-azatricyclo[5.2.2.02,6]undecane.
| Compound Name | 4-methylsulfonyl-4-azatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 154841529 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-methylsulfonyl-4-azatricyclo[5.2.2.02,6]undecane |
| SMILES | CS(=O)(=O)N1CC2C3CCC(CC3)C2C1 |
| InChI | InChI=1S/C11H19NO2S/c1-15(13,14)12-6-10-8-2-3-9(5-4-8)11(10)7-12/h8-11H,2-7H2,1H3 |
| InChIKey | XYMWPOCGPWWAOC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |