About methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate
methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate (PubChem CID 154841935) has the molecular formula C17H21N3O3S
and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate |
| PubChem CID | 154841935 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1ccc(Oc2nc(C3CCCCC3)ns2)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-20(17(21)22-2)13-8-10-14(11-9-13)23-16-18-15(19-24-16)12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3 |
| InChIKey | PIVQMQQVSNUTST-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate?
The IUPAC name of methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate (CID 154841935) is methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate is COC(=O)N(C)c1ccc(Oc2nc(C3CCCCC3)ns2)cc1.
What is the InChIKey of methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate?
The InChIKey is PIVQMQQVSNUTST-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3S/c1-20(17(21)22-2)13-8-10-14(11-9-13)23-16-18-15(19-24-16)12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3.
What are the key properties of methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate?
methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate has a molecular weight of 347.44 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-[(3-cyclohexyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]-N-methylcarbamate is sourced from PubChem (CID 154841935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).