C15H18N2O6 — CID 154842023
6-[2-carboxyethyl(oxan-4-yl)carbamoyl]pyridine-3-carboxylic acid (PubChem CID 154842023) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 6-[2-carboxyethyl(oxan-4-yl)carbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-carboxyethyl(oxan-4-yl)carbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 154842023 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 6-[2-carboxyethyl(oxan-4-yl)carbamoyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)CCN(C(=O)c1ccc(C(=O)O)cn1)C1CCOCC1 |
| InChI | InChI=1S/C15H18N2O6/c18-13(19)3-6-17(11-4-7-23-8-5-11)14(20)12-2-1-10(9-16-12)15(21)22/h1-2,9,11H,3-8H2,(H,18,19)(H,21,22) |
| InChIKey | RTKXOMDADXLJAC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |