C23H32N2O3 — CID 154842260
1-(2-cyclopentylcyclopropanecarbonyl)-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 154842260) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(2-cyclopentylcyclopropanecarbonyl)-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-cyclopentylcyclopropanecarbonyl)-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154842260 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-(2-cyclopentylcyclopropanecarbonyl)-N-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2CCN(C(=O)C3CC3C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-28-19-8-6-16(7-9-19)15-24-22(26)18-10-12-25(13-11-18)23(27)21-14-20(21)17-4-2-3-5-17/h6-9,17-18,20-21H,2-5,10-15H2,1H3,(H,24,26) |
| InChIKey | YOOGXXWEMBXHOK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |