C13H20N2O3 — CID 154842378
3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclopentan-1-one (PubChem CID 154842378) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclopentan-1-one.
| Compound Name | 3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 154842378 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclopentan-1-one |
| SMILES | O=C1CCC(C(=O)N2CCN3C[C@H](O)C[C@H]3C2)C1 |
| InChI | InChI=1S/C13H20N2O3/c16-11-2-1-9(5-11)13(18)15-4-3-14-8-12(17)6-10(14)7-15/h9-10,12,17H,1-8H2/t9?,10-,12+/m0/s1 |
| InChIKey | NOOBVKWRKPMTCZ-OJBNZGHXSA-N |
| XLogP | -0.37 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |