About N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide
N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide (PubChem CID 154843738) has the molecular formula C13H15FN4O2
and a molecular weight of 278.29 g/mol. Its IUPAC name is N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide.
Molecular Properties
| Compound Name | N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide |
| PubChem CID | 154843738 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide |
| SMILES | CC(C)(C)C(=O)NNC(=O)c1ccc2[nH]cnc2c1F |
| InChI | InChI=1S/C13H15FN4O2/c1-13(2,3)12(20)18-17-11(19)7-4-5-8-10(9(7)14)16-6-15-8/h4-6H,1-3H3,(H,15,16)(H,17,19)(H,18,20) |
| InChIKey | LTCBQXHJTSMAPY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide?
The IUPAC name of N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide (CID 154843738) is N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide.
What is the SMILES notation for N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide?
The canonical SMILES for N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide is CC(C)(C)C(=O)NNC(=O)c1ccc2[nH]cnc2c1F.
What is the InChIKey of N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide?
The InChIKey is LTCBQXHJTSMAPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN4O2/c1-13(2,3)12(20)18-17-11(19)7-4-5-8-10(9(7)14)16-6-15-8/h4-6H,1-3H3,(H,15,16)(H,17,19)(H,18,20).
What are the key properties of N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide?
N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide has a molecular weight of 278.29 g/mol, XLogP of 1.51, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-dimethylpropanoyl)-4-fluoro-1H-benzimidazole-5-carbohydrazide is sourced from PubChem (CID 154843738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).