About N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide
N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 154844001) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| PubChem CID | 154844001 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | Cc1sc(=O)n(CC(=O)NCCC(N)Cc2ccccc2)c1C |
| InChI | InChI=1S/C17H23N3O2S/c1-12-13(2)23-17(22)20(12)11-16(21)19-9-8-15(18)10-14-6-4-3-5-7-14/h3-7,15H,8-11,18H2,1-2H3,(H,19,21) |
| InChIKey | JHAWZYJHDDVALI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The IUPAC name of N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide (CID 154844001) is N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide.
What is the SMILES notation for N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The canonical SMILES for N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide is Cc1sc(=O)n(CC(=O)NCCC(N)Cc2ccccc2)c1C.
What is the InChIKey of N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide?
The InChIKey is JHAWZYJHDDVALI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2S/c1-12-13(2)23-17(22)20(12)11-16(21)19-9-8-15(18)10-14-6-4-3-5-7-14/h3-7,15H,8-11,18H2,1-2H3,(H,19,21).
What are the key properties of N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide?
N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide has a molecular weight of 333.46 g/mol, XLogP of 1.60, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-4-phenylbutyl)-2-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)acetamide is sourced from PubChem (CID 154844001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).