About 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one
3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one (PubChem CID 154844054) has the molecular formula C16H20ClFN2O2
and a molecular weight of 326.80 g/mol. Its IUPAC name is 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one |
| PubChem CID | 154844054 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one |
| SMILES | CCN1CCC(N[C@@H]2CCO[C@H]2c2ccc(Cl)c(F)c2)C1=O |
| InChI | InChI=1S/C16H20ClFN2O2/c1-2-20-7-5-14(16(20)21)19-13-6-8-22-15(13)10-3-4-11(17)12(18)9-10/h3-4,9,13-15,19H,2,5-8H2,1H3/t13-,14?,15+/m1/s1 |
| InChIKey | ZCPYJQFIGCQMLZ-LOWNFYCTSA-N |
| XLogP | 2.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one?
The IUPAC name of 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one (CID 154844054) is 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one.
What is the SMILES notation for 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one?
The canonical SMILES for 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one is CCN1CCC(N[C@@H]2CCO[C@H]2c2ccc(Cl)c(F)c2)C1=O.
What is the InChIKey of 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one?
The InChIKey is ZCPYJQFIGCQMLZ-LOWNFYCTSA-N. The full InChI is InChI=1S/C16H20ClFN2O2/c1-2-20-7-5-14(16(20)21)19-13-6-8-22-15(13)10-3-4-11(17)12(18)9-10/h3-4,9,13-15,19H,2,5-8H2,1H3/t13-,14?,15+/m1/s1.
What are the key properties of 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one?
3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one has a molecular weight of 326.80 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-1-ethylpyrrolidin-2-one is sourced from PubChem (CID 154844054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).