C15H24N4O2 — CID 154844791
(4aR,7aS)-4-(4-tert-butyl-1,3,5-triazin-2-yl)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine (PubChem CID 154844791) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4aR,7aS)-4-(4-tert-butyl-1,3,5-triazin-2-yl)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-(4-tert-butyl-1,3,5-triazin-2-yl)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 154844791 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (4aR,7aS)-4-(4-tert-butyl-1,3,5-triazin-2-yl)-2,2-dimethyl-4a,5,7,7a-tetrahydro-3H-furo[3,4-b][1,4]oxazine |
| SMILES | CC1(C)CN(c2ncnc(C(C)(C)C)n2)[C@@H]2COC[C@H]2O1 |
| InChI | InChI=1S/C15H24N4O2/c1-14(2,3)12-16-9-17-13(18-12)19-8-15(4,5)21-11-7-20-6-10(11)19/h9-11H,6-8H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | SMSJGZBEEBKKKA-GHMZBOCLSA-N |
| XLogP | 1.55 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |