About 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid
4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid (PubChem CID 154845323) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid |
| PubChem CID | 154845323 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid |
| SMILES | Cc1nnc(N2CCC(C)(C(=O)O)CC2)o1 |
| InChI | InChI=1S/C10H15N3O3/c1-7-11-12-9(16-7)13-5-3-10(2,4-6-13)8(14)15/h3-6H2,1-2H3,(H,14,15) |
| InChIKey | VMGPBGWXFHXJJX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid?
The IUPAC name of 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid (CID 154845323) is 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid is Cc1nnc(N2CCC(C)(C(=O)O)CC2)o1.
What is the InChIKey of 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid?
The InChIKey is VMGPBGWXFHXJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-7-11-12-9(16-7)13-5-3-10(2,4-6-13)8(14)15/h3-6H2,1-2H3,(H,14,15).
What are the key properties of 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid?
4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid has a molecular weight of 225.25 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine-4-carboxylic acid is sourced from PubChem (CID 154845323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).