C20H18F2N2O — CID 154845372
4-[[2-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]-2H-isoquinolin-1-one (PubChem CID 154845372) has the molecular formula C20H18F2N2O and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-[[2-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]-2H-isoquinolin-1-one.
| Compound Name | 4-[[2-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 154845372 |
| Molecular Formula | C20H18F2N2O |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-[[2-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]cc(CN2CCCC2c2ccc(F)c(F)c2)c2ccccc12 |
| InChI | InChI=1S/C20H18F2N2O/c21-17-8-7-13(10-18(17)22)19-6-3-9-24(19)12-14-11-23-20(25)16-5-2-1-4-15(14)16/h1-2,4-5,7-8,10-11,19H,3,6,9,12H2,(H,23,25) |
| InChIKey | RMWVOZLZZQGCNW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |