C18H20N4O3 — CID 154845518
3-methyl-4-[4-(3-methylpyrazin-2-yl)piperazine-1-carbonyl]benzoic acid (PubChem CID 154845518) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-methyl-4-[4-(3-methylpyrazin-2-yl)piperazine-1-carbonyl]benzoic acid.
| Compound Name | 3-methyl-4-[4-(3-methylpyrazin-2-yl)piperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 154845518 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-methyl-4-[4-(3-methylpyrazin-2-yl)piperazine-1-carbonyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1C(=O)N1CCN(c2nccnc2C)CC1 |
| InChI | InChI=1S/C18H20N4O3/c1-12-11-14(18(24)25)3-4-15(12)17(23)22-9-7-21(8-10-22)16-13(2)19-5-6-20-16/h3-6,11H,7-10H2,1-2H3,(H,24,25) |
| InChIKey | AHZUZFPVOHHVDR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |