C20H30N2O3 — CID 154845582
1-[2-[2,5-di(propan-2-yl)anilino]-2-oxoethyl]piperidine-3-carboxylic acid (PubChem CID 154845582) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[2-[2,5-di(propan-2-yl)anilino]-2-oxoethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[2,5-di(propan-2-yl)anilino]-2-oxoethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154845582 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[2-[2,5-di(propan-2-yl)anilino]-2-oxoethyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)c1ccc(C(C)C)c(NC(=O)CN2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C20H30N2O3/c1-13(2)15-7-8-17(14(3)4)18(10-15)21-19(23)12-22-9-5-6-16(11-22)20(24)25/h7-8,10,13-14,16H,5-6,9,11-12H2,1-4H3,(H,21,23)(H,24,25) |
| InChIKey | BDPXICOTWOYTIG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |