C39H51N5O5 — CID 15484559
(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-[(2-phenyl-1H-indol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 15484559) has the molecular formula C39H51N5O5 and a molecular weight of 669.87 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-[(2-phenyl-1H-indol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-[(2-phenyl-1H-indol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 15484559 |
| Molecular Formula | C39H51N5O5 |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.39 |
| IUPAC Name | (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-[(2-phenyl-1H-indol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](Cc2c(-c3ccccc3)[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C39H51N5O5/c1-4-25(3)34-39(49)44-23-15-14-22-33(44)38(48)41-31(21-11-7-10-18-27(45)5-2)36(46)42-32(37(47)43-34)24-29-28-19-12-13-20-30(28)40-35(29)26-16-8-6-9-17-26/h6,8-9,12-13,16-17,19-20,25,31-34,40H,4-5,7,10-11,14-15,18,21-24H2,1-3H3,(H,41,48)(H,42,46)(H,43,47)/t25-,31-,32-,33+,34-/m0/s1 |
| InChIKey | KDHIRMDJSXORPI-NHNPLKQTSA-N |
| XLogP | 5.20 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|