About N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide
N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide (PubChem CID 154845668) has the molecular formula C18H23F2NO2
and a molecular weight of 323.38 g/mol. Its IUPAC name is N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide.
Molecular Properties
| Compound Name | N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide |
| PubChem CID | 154845668 |
| Molecular Formula | C18H23F2NO2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide |
| SMILES | CCC(O)(C(=O)NC1CC12CCC(F)(F)CC2)c1ccccc1 |
| InChI | InChI=1S/C18H23F2NO2/c1-2-18(23,13-6-4-3-5-7-13)15(22)21-14-12-16(14)8-10-17(19,20)11-9-16/h3-7,14,23H,2,8-12H2,1H3,(H,21,22) |
| InChIKey | OKOVCPAZQMTVCB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide?
The IUPAC name of N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide (CID 154845668) is N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide.
What is the SMILES notation for N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide?
The canonical SMILES for N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide is CCC(O)(C(=O)NC1CC12CCC(F)(F)CC2)c1ccccc1.
What is the InChIKey of N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide?
The InChIKey is OKOVCPAZQMTVCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2NO2/c1-2-18(23,13-6-4-3-5-7-13)15(22)21-14-12-16(14)8-10-17(19,20)11-9-16/h3-7,14,23H,2,8-12H2,1H3,(H,21,22).
What are the key properties of N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide?
N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide has a molecular weight of 323.38 g/mol, XLogP of 3.37, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,6-difluorospiro[2.5]octan-2-yl)-2-hydroxy-2-phenylbutanamide is sourced from PubChem (CID 154845668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).