About 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid
3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid (PubChem CID 154846426) has the molecular formula C14H14ClF2NO4
and a molecular weight of 333.72 g/mol. Its IUPAC name is 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid |
| PubChem CID | 154846426 |
| Molecular Formula | C14H14ClF2NO4 |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)NC2CCOCCC2(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H14ClF2NO4/c15-10-7-8(13(20)21)1-2-9(10)12(19)18-11-3-5-22-6-4-14(11,16)17/h1-2,7,11H,3-6H2,(H,18,19)(H,20,21) |
| InChIKey | FFSFDNYLJZRWQQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid?
The IUPAC name of 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid (CID 154846426) is 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid.
What is the SMILES notation for 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid?
The canonical SMILES for 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid is O=C(O)c1ccc(C(=O)NC2CCOCCC2(F)F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid?
The InChIKey is FFSFDNYLJZRWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF2NO4/c15-10-7-8(13(20)21)1-2-9(10)12(19)18-11-3-5-22-6-4-14(11,16)17/h1-2,7,11H,3-6H2,(H,18,19)(H,20,21).
What are the key properties of 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid?
3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid has a molecular weight of 333.72 g/mol, XLogP of 2.58, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(5,5-difluorooxepan-4-yl)carbamoyl]benzoic acid is sourced from PubChem (CID 154846426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).