C12H16F5NO4 — CID 154846623
(2R,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidine-2-carboxylic acid (PubChem CID 154846623) has the molecular formula C12H16F5NO4 and a molecular weight of 333.25 g/mol. Its IUPAC name is (2R,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 154846623 |
| Molecular Formula | C12H16F5NO4 |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2R,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C(F)(F)C(F)(F)F)[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H16F5NO4/c1-10(2,3)22-9(21)18-5-4-6(7(18)8(19)20)11(13,14)12(15,16)17/h6-7H,4-5H2,1-3H3,(H,19,20)/t6-,7+/m0/s1 |
| InChIKey | VOEPLWTXPWGUHG-NKWVEPMBSA-N |
| XLogP | 2.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|