C24H27NO6 — CID 15484696
ethyl (1R,6R,9R,10R,14S)-2-ethyl-8,11,13-trioxo-12-phenyl-15-oxa-12-azatetracyclo[7.5.1.01,6.010,14]pentadecane-9-carboxylate (PubChem CID 15484696) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is ethyl (1R,6R,9R,10R,14S)-2-ethyl-8,11,13-trioxo-12-phenyl-15-oxa-12-azatetracyclo[7.5.1.01,6.010,14]pentadecane-9-carboxylate.
| Compound Name | ethyl (1R,6R,9R,10R,14S)-2-ethyl-8,11,13-trioxo-12-phenyl-15-oxa-12-azatetracyclo[7.5.1.01,6.010,14]pentadecane-9-carboxylate |
|---|---|
| PubChem CID | 15484696 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | ethyl (1R,6R,9R,10R,14S)-2-ethyl-8,11,13-trioxo-12-phenyl-15-oxa-12-azatetracyclo[7.5.1.01,6.010,14]pentadecane-9-carboxylate |
| SMILES | CCOC(=O)[C@]12O[C@@]3(C(CC)CCC[C@@H]3CC1=O)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H27NO6/c1-3-14-9-8-10-15-13-17(26)24(22(29)30-4-2)19-18(23(14,15)31-24)20(27)25(21(19)28)16-11-6-5-7-12-16/h5-7,11-12,14-15,18-19H,3-4,8-10,13H2,1-2H3/t14?,15-,18-,19+,23-,24+/m1/s1 |
| InChIKey | ILHLNFXCUHKGFR-GVDPREDDSA-N |
| XLogP | 2.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|