About 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide
2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 154847437) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide |
| PubChem CID | 154847437 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | C[C@@H]1OCC[C@@H]1CCNC(=O)c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C15H21N3O3/c1-9-10(5-7-21-9)4-6-16-15(20)12-8-13(19)18-14(17-12)11-2-3-11/h8-11H,2-7H2,1H3,(H,16,20)(H,17,18,19)/t9-,10-/m0/s1 |
| InChIKey | WLZVQJATWRSAEN-UWVGGRQHSA-N |
| XLogP | 1.19 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide?
The IUPAC name of 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide (CID 154847437) is 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide is C[C@@H]1OCC[C@@H]1CCNC(=O)c1cc(=O)[nH]c(C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide?
The InChIKey is WLZVQJATWRSAEN-UWVGGRQHSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-9-10(5-7-21-9)4-6-16-15(20)12-8-13(19)18-14(17-12)11-2-3-11/h8-11H,2-7H2,1H3,(H,16,20)(H,17,18,19)/t9-,10-/m0/s1.
What are the key properties of 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide?
2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide has a molecular weight of 291.35 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[2-[(2S,3S)-2-methyloxolan-3-yl]ethyl]-6-oxo-1H-pyrimidine-4-carboxamide is sourced from PubChem (CID 154847437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).