C15H19Cl2N3O2 — CID 154847922
1-[4-(2,6-dichloro-3-methylpyridine-4-carbonyl)piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 154847922) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-[4-(2,6-dichloro-3-methylpyridine-4-carbonyl)piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-(2,6-dichloro-3-methylpyridine-4-carbonyl)piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 154847922 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-[4-(2,6-dichloro-3-methylpyridine-4-carbonyl)piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)C(C)C)CC2)cc(Cl)nc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-9(2)14(21)19-4-6-20(7-5-19)15(22)11-8-12(16)18-13(17)10(11)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | BIGFAOQYBIAPFW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|