About 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea
3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea (PubChem CID 154848172) has the molecular formula C18H21N5O2S
and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea.
Molecular Properties
| Compound Name | 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea |
| PubChem CID | 154848172 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea |
| SMILES | CC(c1ccc(S(C)=O)cc1)N(C)C(=O)NCc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C18H21N5O2S/c1-12(13-6-8-14(9-7-13)26(3)25)23(2)18(24)20-11-16-21-15-5-4-10-19-17(15)22-16/h4-10,12H,11H2,1-3H3,(H,20,24)(H,19,21,22) |
| InChIKey | YVDCFUIIEXZBTO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea?
The IUPAC name of 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea (CID 154848172) is 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea.
What is the SMILES notation for 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea?
The canonical SMILES for 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea is CC(c1ccc(S(C)=O)cc1)N(C)C(=O)NCc1nc2ncccc2[nH]1.
What is the InChIKey of 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea?
The InChIKey is YVDCFUIIEXZBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O2S/c1-12(13-6-8-14(9-7-13)26(3)25)23(2)18(24)20-11-16-21-15-5-4-10-19-17(15)22-16/h4-10,12H,11H2,1-3H3,(H,20,24)(H,19,21,22).
What are the key properties of 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea?
3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea has a molecular weight of 371.47 g/mol, XLogP of 2.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-1-methyl-1-[1-(4-methylsulfinylphenyl)ethyl]urea is sourced from PubChem (CID 154848172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).