C30H30N2O3 — CID 154849567
4-benzyl-9-(4-phenylpiperidine-1-carbonyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 154849567) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-benzyl-9-(4-phenylpiperidine-1-carbonyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | 4-benzyl-9-(4-phenylpiperidine-1-carbonyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 154849567 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 4-benzyl-9-(4-phenylpiperidine-1-carbonyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(C1C2C3C=CC(C4C(=O)N(Cc5ccccc5)C(=O)C34)C12)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H30N2O3/c33-28(31-15-13-20(14-16-31)19-9-5-2-6-10-19)27-23-21-11-12-22(24(23)27)26-25(21)29(34)32(30(26)35)17-18-7-3-1-4-8-18/h1-12,20-27H,13-17H2 |
| InChIKey | JWJUQJBLHDGFHR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|