C26H29N3O5 — CID 154849569
1-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-2-(4-phenylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 154849569) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-2-(4-phenylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-2-(4-phenylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 154849569 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)piperazin-1-yl]-2-(4-phenylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)C2COc3ccccc3O2)CC1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O5/c30-24(23-18-33-21-8-4-5-9-22(21)34-23)28-14-16-29(17-15-28)26(32)25(31)27-12-10-20(11-13-27)19-6-2-1-3-7-19/h1-9,20,23H,10-18H2 |
| InChIKey | WNYRPFPAIRFXEJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|