C11H9F3O3 — CID 15484969
4,4-difluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione (PubChem CID 15484969) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is 4,4-difluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione.
| Compound Name | 4,4-difluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 15484969 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 4,4-difluoro-1-(3-fluoro-4-methoxyphenyl)butane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(=O)C(F)F)cc1F |
| InChI | InChI=1S/C11H9F3O3/c1-17-10-3-2-6(4-7(10)12)8(15)5-9(16)11(13)14/h2-4,11H,5H2,1H3 |
| InChIKey | QNQIALSSNJBPCV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|