About 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea
1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea (PubChem CID 154851015) has the molecular formula C25H26N2O2
and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea.
Molecular Properties
| Compound Name | 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea |
| PubChem CID | 154851015 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea |
| SMILES | Cc1cccc(-c2cccc(CNC(=O)NC3COc4c(C)cccc4C3)c2)c1 |
| InChI | InChI=1S/C25H26N2O2/c1-17-6-3-9-20(12-17)21-10-5-8-19(13-21)15-26-25(28)27-23-14-22-11-4-7-18(2)24(22)29-16-23/h3-13,23H,14-16H2,1-2H3,(H2,26,27,28) |
| InChIKey | SAASZOXEHPOZFC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea?
The IUPAC name of 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea (CID 154851015) is 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea.
What is the SMILES notation for 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea?
The canonical SMILES for 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea is Cc1cccc(-c2cccc(CNC(=O)NC3COc4c(C)cccc4C3)c2)c1.
What is the InChIKey of 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea?
The InChIKey is SAASZOXEHPOZFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O2/c1-17-6-3-9-20(12-17)21-10-5-8-19(13-21)15-26-25(28)27-23-14-22-11-4-7-18(2)24(22)29-16-23/h3-13,23H,14-16H2,1-2H3,(H2,26,27,28).
What are the key properties of 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea?
1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea has a molecular weight of 386.50 g/mol, XLogP of 4.77, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-methyl-3,4-dihydro-2H-chromen-3-yl)-3-[[3-(3-methylphenyl)phenyl]methyl]urea is sourced from PubChem (CID 154851015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).