C14H17F3N4O — CID 154851043
1-[(3aS,6aR)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 154851043) has the molecular formula C14H17F3N4O and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[(3aS,6aR)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 154851043 |
| Molecular Formula | C14H17F3N4O |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[(3aS,6aR)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1C[C@@H]2CN(c3ncccn3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H17F3N4O/c15-14(16,17)3-2-12(22)20-6-10-8-21(9-11(10)7-20)13-18-4-1-5-19-13/h1,4-5,10-11H,2-3,6-9H2/t10-,11+ |
| InChIKey | XNXRJROYLBLZCX-PHIMTYICSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |