C23H22F3N3O3 — CID 154851475
N-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)phenyl]methyl]-4-methyl-3-(trifluoromethyl)benzamide (PubChem CID 154851475) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is N-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)phenyl]methyl]-4-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)phenyl]methyl]-4-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 154851475 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)phenyl]methyl]-4-methyl-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCc2cccc(N3C(=O)NC4(CCCC4)C3=O)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H22F3N3O3/c1-14-7-8-16(12-18(14)23(24,25)26)19(30)27-13-15-5-4-6-17(11-15)29-20(31)22(28-21(29)32)9-2-3-10-22/h4-8,11-12H,2-3,9-10,13H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | CQIQKPXFWJMCHM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|