C17H24N6O4S — CID 154852514
N-methyl-N-[2-(N-methyl-4-sulfamoylanilino)ethyl]-3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 154852514) has the molecular formula C17H24N6O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-methyl-N-[2-(N-methyl-4-sulfamoylanilino)ethyl]-3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-methyl-N-[2-(N-methyl-4-sulfamoylanilino)ethyl]-3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 154852514 |
| Molecular Formula | C17H24N6O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-methyl-N-[2-(N-methyl-4-sulfamoylanilino)ethyl]-3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | CN(CCN(C)c1ccc(S(N)(=O)=O)cc1)C(=O)C1CCc2n[nH]c(=O)n2C1 |
| InChI | InChI=1S/C17H24N6O4S/c1-21(13-4-6-14(7-5-13)28(18,26)27)9-10-22(2)16(24)12-3-8-15-19-20-17(25)23(15)11-12/h4-7,12H,3,8-11H2,1-2H3,(H,20,25)(H2,18,26,27) |
| InChIKey | KGOCDRXKKHYGFU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |