About 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride
5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride (PubChem CID 154852994) has the molecular formula C9H17Cl2N3
and a molecular weight of 238.16 g/mol. Its IUPAC name is 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride.
Molecular Properties
| Compound Name | 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride |
| PubChem CID | 154852994 |
| Molecular Formula | C9H17Cl2N3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride |
| SMILES | CC1(C)CNCC1c1ccn[nH]1.Cl.Cl |
| InChI | InChI=1S/C9H15N3.2ClH/c1-9(2)6-10-5-7(9)8-3-4-11-12-8;;/h3-4,7,10H,5-6H2,1-2H3,(H,11,12);2*1H |
| InChIKey | ASLIIRJBWLXLDF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride?
The IUPAC name of 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride (CID 154852994) is 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride.
What is the SMILES notation for 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride?
The canonical SMILES for 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride is CC1(C)CNCC1c1ccn[nH]1.Cl.Cl.
What is the InChIKey of 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride?
The InChIKey is ASLIIRJBWLXLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3.2ClH/c1-9(2)6-10-5-7(9)8-3-4-11-12-8;;/h3-4,7,10H,5-6H2,1-2H3,(H,11,12);2*1H.
What are the key properties of 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride?
5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride has a molecular weight of 238.16 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethylpyrrolidin-3-yl)-1H-pyrazole;dihydrochloride is sourced from PubChem (CID 154852994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).