C16H22BrClN2O — CID 154853099
(7R,8aS)-2-[(3-bromo-2-chlorophenyl)methyl]-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 154853099) has the molecular formula C16H22BrClN2O and a molecular weight of 373.72 g/mol. Its IUPAC name is (7R,8aS)-2-[(3-bromo-2-chlorophenyl)methyl]-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-2-[(3-bromo-2-chlorophenyl)methyl]-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 154853099 |
| Molecular Formula | C16H22BrClN2O |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (7R,8aS)-2-[(3-bromo-2-chlorophenyl)methyl]-7-ethoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCO[C@@H]1C[C@H]2CN(Cc3cccc(Br)c3Cl)CCN2C1 |
| InChI | InChI=1S/C16H22BrClN2O/c1-2-21-14-8-13-10-19(6-7-20(13)11-14)9-12-4-3-5-15(17)16(12)18/h3-5,13-14H,2,6-11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | QIMNYKXDBJQYLC-UONOGXRCSA-N |
| XLogP | 3.40 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |