C19H20N2O5S — CID 154854273
2-(3,4-dimethoxyphenyl)-4-(2-methylprop-2-enyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 154854273) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-(2-methylprop-2-enyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-(2-methylprop-2-enyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 154854273 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-(2-methylprop-2-enyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | C=C(C)CN1C(=O)N(c2ccc(OC)c(OC)c2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H20N2O5S/c1-13(2)12-20-15-7-5-6-8-18(15)27(23,24)21(19(20)22)14-9-10-16(25-3)17(11-14)26-4/h5-11H,1,12H2,2-4H3 |
| InChIKey | KTSZAWVSIVGPIY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|