C25H21ClN4O4S — CID 154854488
2-(5-chloro-2-methylphenyl)-4-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 154854488) has the molecular formula C25H21ClN4O4S and a molecular weight of 508.99 g/mol. Its IUPAC name is 2-(5-chloro-2-methylphenyl)-4-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(5-chloro-2-methylphenyl)-4-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 154854488 |
| Molecular Formula | C25H21ClN4O4S |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 2-(5-chloro-2-methylphenyl)-4-[[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | Cc1cc(C)cc(-c2nnc(CN3C(=O)N(c4cc(Cl)ccc4C)S(=O)(=O)c4ccccc43)o2)c1 |
| InChI | InChI=1S/C25H21ClN4O4S/c1-15-10-16(2)12-18(11-15)24-28-27-23(34-24)14-29-20-6-4-5-7-22(20)35(32,33)30(25(29)31)21-13-19(26)9-8-17(21)3/h4-13H,14H2,1-3H3 |
| InChIKey | ZGZPBTOHDKCHGW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |