C17H21F3N4O2 — CID 154855156
[4-(4,5-dihydro-1,2-oxazol-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanone (PubChem CID 154855156) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is [4-(4,5-dihydro-1,2-oxazol-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanone.
| Compound Name | [4-(4,5-dihydro-1,2-oxazol-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 154855156 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [4-(4,5-dihydro-1,2-oxazol-3-yl)piperidin-1-yl]-[3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]methanone |
| SMILES | O=C(c1nc(C(F)(F)F)n2c1CCCC2)N1CCC(C2=NOCC2)CC1 |
| InChI | InChI=1S/C17H21F3N4O2/c18-17(19,20)16-21-14(13-3-1-2-7-24(13)16)15(25)23-8-4-11(5-9-23)12-6-10-26-22-12/h11H,1-10H2 |
| InChIKey | NNTAHFDBAQJUNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |