C19H22N2O5 — CID 154856024
4-[(3aR,6aS)-5-(5,6-dihydro-4H-cyclopenta[c]furan-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]oxolan-2-one (PubChem CID 154856024) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-[(3aR,6aS)-5-(5,6-dihydro-4H-cyclopenta[c]furan-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]oxolan-2-one.
| Compound Name | 4-[(3aR,6aS)-5-(5,6-dihydro-4H-cyclopenta[c]furan-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]oxolan-2-one |
|---|---|
| PubChem CID | 154856024 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[(3aR,6aS)-5-(5,6-dihydro-4H-cyclopenta[c]furan-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]oxolan-2-one |
| SMILES | O=C1CC(C(=O)N2C[C@H]3CN(C(=O)c4occ5c4CCC5)C[C@H]3C2)CO1 |
| InChI | InChI=1S/C19H22N2O5/c22-16-4-12(10-25-16)18(23)20-5-13-7-21(8-14(13)6-20)19(24)17-15-3-1-2-11(15)9-26-17/h9,12-14H,1-8,10H2/t12?,13-,14+ |
| InChIKey | KBJGIOYXZJGSKD-AGUYFDCRSA-N |
| XLogP | 0.86 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |