About 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile
3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile (PubChem CID 154856881) has the molecular formula C18H15ClN2O
and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile |
| PubChem CID | 154856881 |
| Molecular Formula | C18H15ClN2O |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2CN(C(=O)CCl)Cc3ccccc32)c1 |
| InChI | InChI=1S/C18H15ClN2O/c19-9-18(22)21-11-15-5-1-2-7-16(15)17(12-21)14-6-3-4-13(8-14)10-20/h1-8,17H,9,11-12H2 |
| InChIKey | KKJBJMPUNLISGA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile?
The IUPAC name of 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile (CID 154856881) is 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile.
What is the SMILES notation for 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile?
The canonical SMILES for 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile is N#Cc1cccc(C2CN(C(=O)CCl)Cc3ccccc32)c1.
What is the InChIKey of 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile?
The InChIKey is KKJBJMPUNLISGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O/c19-9-18(22)21-11-15-5-1-2-7-16(15)17(12-21)14-6-3-4-13(8-14)10-20/h1-8,17H,9,11-12H2.
What are the key properties of 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile?
3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile has a molecular weight of 310.78 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-chloroacetyl)-3,4-dihydro-1H-isoquinolin-4-yl]benzonitrile is sourced from PubChem (CID 154856881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).