About (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride
(3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride (PubChem CID 154857193) has the molecular formula C5H10Cl2N2OS
and a molecular weight of 217.12 g/mol. Its IUPAC name is (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride |
| PubChem CID | 154857193 |
| Molecular Formula | C5H10Cl2N2OS |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride |
| SMILES | COc1cc(CN)sn1.Cl.Cl |
| InChI | InChI=1S/C5H8N2OS.2ClH/c1-8-5-2-4(3-6)9-7-5;;/h2H,3,6H2,1H3;2*1H |
| InChIKey | JUIKNALGXRMNDM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride?
The IUPAC name of (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride (CID 154857193) is (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride.
What is the SMILES notation for (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride?
The canonical SMILES for (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride is COc1cc(CN)sn1.Cl.Cl.
What is the InChIKey of (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride?
The InChIKey is JUIKNALGXRMNDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS.2ClH/c1-8-5-2-4(3-6)9-7-5;;/h2H,3,6H2,1H3;2*1H.
What are the key properties of (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride?
(3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride has a molecular weight of 217.12 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-1,2-thiazol-5-yl)methanamine;dihydrochloride is sourced from PubChem (CID 154857193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).