C9H15Cl2N3O — CID 154857238
2-methyl-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride (PubChem CID 154857238) has the molecular formula C9H15Cl2N3O and a molecular weight of 252.14 g/mol. Its IUPAC name is 2-methyl-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride.
| Compound Name | 2-methyl-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 154857238 |
| Molecular Formula | C9H15Cl2N3O |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-methyl-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride |
| SMILES | Cc1nc2c(c(=O)[nH]1)CCNCC2.Cl.Cl |
| InChI | InChI=1S/C9H13N3O.2ClH/c1-6-11-8-3-5-10-4-2-7(8)9(13)12-6;;/h10H,2-5H2,1H3,(H,11,12,13);2*1H |
| InChIKey | QAFLYMWQZOZPGH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |