About 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride
2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride (PubChem CID 154857245) has the molecular formula C9H11ClF3N
and a molecular weight of 225.64 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride |
| PubChem CID | 154857245 |
| Molecular Formula | C9H11ClF3N |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride |
| SMILES | CC(C)(N)c1cc(F)c(F)c(F)c1.Cl |
| InChI | InChI=1S/C9H10F3N.ClH/c1-9(2,13)5-3-6(10)8(12)7(11)4-5;/h3-4H,13H2,1-2H3;1H |
| InChIKey | BDUBJQHMTQTTRB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride?
The IUPAC name of 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride (CID 154857245) is 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride.
What is the SMILES notation for 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride?
The canonical SMILES for 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride is CC(C)(N)c1cc(F)c(F)c(F)c1.Cl.
What is the InChIKey of 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride?
The InChIKey is BDUBJQHMTQTTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N.ClH/c1-9(2,13)5-3-6(10)8(12)7(11)4-5;/h3-4H,13H2,1-2H3;1H.
What are the key properties of 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride?
2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride has a molecular weight of 225.64 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride is sourced from PubChem (CID 154857245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).