About N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide
N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 154857529) has the molecular formula C11H15F2N3OS
and a molecular weight of 275.32 g/mol. Its IUPAC name is N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide |
| PubChem CID | 154857529 |
| Molecular Formula | C11H15F2N3OS |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H15F2N3OS/c1-7-9(18-16-15-7)10(17)14-6-8-3-2-4-11(12,13)5-8/h8H,2-6H2,1H3,(H,14,17) |
| InChIKey | QDTDZJRMFGNDCE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide?
The IUPAC name of N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide (CID 154857529) is N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide.
What is the SMILES notation for N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide?
The canonical SMILES for N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide is Cc1nnsc1C(=O)NCC1CCCC(F)(F)C1.
What is the InChIKey of N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide?
The InChIKey is QDTDZJRMFGNDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3OS/c1-7-9(18-16-15-7)10(17)14-6-8-3-2-4-11(12,13)5-8/h8H,2-6H2,1H3,(H,14,17).
What are the key properties of N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide?
N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide has a molecular weight of 275.32 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclohexyl)methyl]-4-methylthiadiazole-5-carboxamide is sourced from PubChem (CID 154857529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).