C24H21F5O5 — CID 15485755
tert-butyl 3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-3-oxo-2-(2,3,4,5,6-pentafluorophenyl)propanoate (PubChem CID 15485755) has the molecular formula C24H21F5O5 and a molecular weight of 484.42 g/mol. Its IUPAC name is tert-butyl 3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-3-oxo-2-(2,3,4,5,6-pentafluorophenyl)propanoate.
| Compound Name | tert-butyl 3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-3-oxo-2-(2,3,4,5,6-pentafluorophenyl)propanoate |
|---|---|
| PubChem CID | 15485755 |
| Molecular Formula | C24H21F5O5 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | tert-butyl 3-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-3-oxo-2-(2,3,4,5,6-pentafluorophenyl)propanoate |
| SMILES | CCOC(=O)/C=C/c1ccc(C(=O)C(C(=O)OC(C)(C)C)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H21F5O5/c1-5-33-14(30)11-8-12-6-9-13(10-7-12)22(31)16(23(32)34-24(2,3)4)15-17(25)19(27)21(29)20(28)18(15)26/h6-11,16H,5H2,1-4H3/b11-8+ |
| InChIKey | JOZPHTFJLKPLJE-DHZHZOJOSA-N |
| XLogP | 5.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|